| Name | trans-Stilbene oxide |
| Synonyms | trans-Stilbene oxide trans-Stilbene Oxide TRANS-STILBENE OXIDE trans-Stilbene oxide, trans-1,2-Diphenylethylene oxide |
| CAS | 1439-07-2 |
| EINECS | 215-877-7 |
| InChI | InChI=1/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14-/m1/s1 |
| Molecular Formula | C14H12O |
| Molar Mass | 196.24 |
| Density | 1.0405 (rough estimate) |
| Melting Point | 65-67°C(lit.) |
| Boling Point | 273.14°C (rough estimate) |
| Flash Point | 133.4°C |
| Solubility | soluble in Toluene |
| Vapor Presure | 0.00157mmHg at 25°C |
| Appearance | Crystals |
| Color | White |
| BRN | 82740 |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4700 (estimate) |
| Hazard Symbols | F - Flammable![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | DT4391500 |
| HS Code | 29109000 |
| Hazard Note | Flammable |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |